C13H26BNO4 — CID 10564024
methyl N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]carbamate (PubChem CID 10564024) has the molecular formula C13H26BNO4 and a molecular weight of 271.17 g/mol. Its IUPAC name is methyl N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]carbamate.
| Compound Name | methyl N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 10564024 |
| Molecular Formula | C13H26BNO4 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | methyl N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]carbamate |
| SMILES | CCCCC(NC(=O)OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H26BNO4/c1-7-8-9-10(15-11(16)17-6)14-18-12(2,3)13(4,5)19-14/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | HWURLNSQFJFERD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|