C22H35BO2 — CID 122232202
4,4,5,5-tetramethyl-2-[(E,3S)-5,6,6-trimethyl-1-phenylhept-4-en-3-yl]-1,3,2-dioxaborolane (PubChem CID 122232202) has the molecular formula C22H35BO2 and a molecular weight of 342.33 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E,3S)-5,6,6-trimethyl-1-phenylhept-4-en-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E,3S)-5,6,6-trimethyl-1-phenylhept-4-en-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 122232202 |
| Molecular Formula | C22H35BO2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E,3S)-5,6,6-trimethyl-1-phenylhept-4-en-3-yl]-1,3,2-dioxaborolane |
| SMILES | C/C(=C\[C@H](CCc1ccccc1)B1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C22H35BO2/c1-17(20(2,3)4)16-19(15-14-18-12-10-9-11-13-18)23-24-21(5,6)22(7,8)25-23/h9-13,16,19H,14-15H2,1-8H3/b17-16+/t19-/m0/s1 |
| InChIKey | QVMGMVPAKNRIMC-PIOKWQJESA-N |
| XLogP | 6.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|