C31H44BNO3 — CID 122232204
(7S)-N,N-dibenzyl-9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-8-enamide (PubChem CID 122232204) has the molecular formula C31H44BNO3 and a molecular weight of 489.51 g/mol. Its IUPAC name is (7S)-N,N-dibenzyl-9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-8-enamide.
| Compound Name | (7S)-N,N-dibenzyl-9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-8-enamide |
|---|---|
| PubChem CID | 122232204 |
| Molecular Formula | C31H44BNO3 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | (7S)-N,N-dibenzyl-9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-8-enamide |
| SMILES | CC(C)=C[C@H](CCCCCC(=O)N(Cc1ccccc1)Cc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C31H44BNO3/c1-25(2)22-28(32-35-30(3,4)31(5,6)36-32)20-14-9-15-21-29(34)33(23-26-16-10-7-11-17-26)24-27-18-12-8-13-19-27/h7-8,10-13,16-19,22,28H,9,14-15,20-21,23-24H2,1-6H3/t28-/m0/s1 |
| InChIKey | WURLUNSINUVGOJ-NDEPHWFRSA-N |
| XLogP | 7.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|