C23H37BO4Si — CID 135850446
[(3S)-3-[dimethyl(phenyl)silyl]-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate (PubChem CID 135850446) has the molecular formula C23H37BO4Si and a molecular weight of 416.44 g/mol. Its IUPAC name is [(3S)-3-[dimethyl(phenyl)silyl]-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate.
| Compound Name | [(3S)-3-[dimethyl(phenyl)silyl]-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate |
|---|---|
| PubChem CID | 135850446 |
| Molecular Formula | C23H37BO4Si |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [(3S)-3-[dimethyl(phenyl)silyl]-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@@H](C(C)(C)COC(C)=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H37BO4Si/c1-17(24-27-22(5,6)23(7,8)28-24)20(21(3,4)16-26-18(2)25)29(9,10)19-14-12-11-13-15-19/h11-15,20H,1,16H2,2-10H3/t20-/m0/s1 |
| InChIKey | BBVHJONNYBVIJY-FQEVSTJZSA-N |
| XLogP | 4.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|