C26H46BNO3Si — CID 129009830
(2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine (PubChem CID 129009830) has the molecular formula C26H46BNO3Si and a molecular weight of 459.56 g/mol. Its IUPAC name is (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine.
| Compound Name | (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 129009830 |
| Molecular Formula | C26H46BNO3Si |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@](C)(N)c1ccccc1C |
| InChI | InChI=1S/C26H46BNO3Si/c1-19-15-13-14-16-21(19)26(10,28)22(17-18-29-32(11,12)23(3,4)5)20(2)27-30-24(6,7)25(8,9)31-27/h13-16,22H,2,17-18,28H2,1,3-12H3/t22-,26-/m0/s1 |
| InChIKey | XYLKUTLFVVVOCT-NVQXNPDNSA-N |
| XLogP | 6.38 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|