C32H52BNO5SSi2 — CID 135061997
N-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 135061997) has the molecular formula C32H52BNO5SSi2 and a molecular weight of 629.82 g/mol. Its IUPAC name is N-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135061997 |
| Molecular Formula | C32H52BNO5SSi2 |
| Molecular Weight | 629.82 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | N-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)/C(B2OC(C)(C)C(C)(C)O2)=C(\CCO[Si](C)(C)C(C)(C)C)[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H52BNO5SSi2/c1-25-19-21-26(22-20-25)40(35,36)34(9)29(33-38-31(5,6)32(7,8)39-33)28(23-24-37-42(12,13)30(2,3)4)41(10,11)27-17-15-14-16-18-27/h14-22H,23-24H2,1-13H3/b29-28+ |
| InChIKey | OYKZCNJGSPYSJJ-ZQHSETAFSA-N |
| XLogP | 7.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|