C30H37NO5SSi — CID 132942378
methyl N-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 132942378) has the molecular formula C30H37NO5SSi and a molecular weight of 551.78 g/mol. Its IUPAC name is methyl N-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | methyl N-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 132942378 |
| Molecular Formula | C30H37NO5SSi |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | methyl N-[(E)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | COC(=O)N(C/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H37NO5SSi/c1-25-19-21-26(22-20-25)37(33,34)31(29(32)35-5)23-13-8-14-24-36-38(30(2,3)4,27-15-9-6-10-16-27)28-17-11-7-12-18-28/h6-13,15-22H,14,23-24H2,1-5H3/b13-8+ |
| InChIKey | UWLKZWBAVVDVTP-MDWZMJQESA-N |
| XLogP | 5.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|