C37H46N2O9SSi — CID 16664048
dimethyl (2R)-2-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]-2-[(Z)-3-[(4-nitrophenyl)sulfonylamino]prop-1-enyl]butanedioate (PubChem CID 16664048) has the molecular formula C37H46N2O9SSi and a molecular weight of 722.93 g/mol. Its IUPAC name is dimethyl (2R)-2-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]-2-[(Z)-3-[(4-nitrophenyl)sulfonylamino]prop-1-enyl]butanedioate.
| Compound Name | dimethyl (2R)-2-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]-2-[(Z)-3-[(4-nitrophenyl)sulfonylamino]prop-1-enyl]butanedioate |
|---|---|
| PubChem CID | 16664048 |
| Molecular Formula | C37H46N2O9SSi |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | dimethyl (2R)-2-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]-2-[(Z)-3-[(4-nitrophenyl)sulfonylamino]prop-1-enyl]butanedioate |
| SMILES | COC(=O)C[C@@](/C=C\CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)(CC/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C37H46N2O9SSi/c1-36(2,3)50(32-17-10-8-11-18-32,33-19-12-9-13-20-33)48-28-15-7-6-14-25-37(35(41)47-5,29-34(40)46-4)26-16-27-38-49(44,45)31-23-21-30(22-24-31)39(42)43/h6-13,16-24,26,38H,14-15,25,27-29H2,1-5H3/b7-6+,26-16-/t37-/m0/s1 |
| InChIKey | GVFRKOZOJQWAEO-XHKOOZEVSA-N |
| XLogP | 5.45 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|