C25H42BF2NO3Si — CID 129009827
(2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,6-difluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine (PubChem CID 129009827) has the molecular formula C25H42BF2NO3Si and a molecular weight of 481.51 g/mol. Its IUPAC name is (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,6-difluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine.
| Compound Name | (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,6-difluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 129009827 |
| Molecular Formula | C25H42BF2NO3Si |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,6-difluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@](C)(N)c1c(F)cccc1F |
| InChI | InChI=1S/C25H42BF2NO3Si/c1-17(26-31-23(5,6)24(7,8)32-26)18(15-16-30-33(10,11)22(2,3)4)25(9,29)21-19(27)13-12-14-20(21)28/h12-14,18H,1,15-16,29H2,2-11H3/t18-,25+/m0/s1 |
| InChIKey | MBDKGVKOWRVGRN-AVRWGWEMSA-N |
| XLogP | 6.35 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|