C14H27NOSSi — CID 18354459
4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutan-1-amine (PubChem CID 18354459) has the molecular formula C14H27NOSSi and a molecular weight of 285.53 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutan-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 18354459 |
| Molecular Formula | C14H27NOSSi |
| Molecular Weight | 285.53 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CN)c1cccs1 |
| InChI | InChI=1S/C14H27NOSSi/c1-14(2,3)18(4,5)16-9-8-12(11-15)13-7-6-10-17-13/h6-7,10,12H,8-9,11,15H2,1-5H3 |
| InChIKey | LDZCZXBDTVBPLB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|