C18H31NOSi — CID 102050161
N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2-methylaniline (PubChem CID 102050161) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2-methylaniline.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 102050161 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2-methylaniline |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)Nc1ccccc1C |
| InChI | InChI=1S/C18H31NOSi/c1-8-16(19-17-12-10-9-11-15(17)2)13-14-20-21(6,7)18(3,4)5/h8-12,16,19H,1,13-14H2,2-7H3 |
| InChIKey | CDBMLIUZSZAZCU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|