C19H33NO4Si — CID 11783543
methyl 5-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyanilino)pentanoate (PubChem CID 11783543) has the molecular formula C19H33NO4Si and a molecular weight of 367.56 g/mol. Its IUPAC name is methyl 5-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyanilino)pentanoate.
| Compound Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyanilino)pentanoate |
|---|---|
| PubChem CID | 11783543 |
| Molecular Formula | C19H33NO4Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyanilino)pentanoate |
| SMILES | COC(=O)CC(CCO[Si](C)(C)C(C)(C)C)Nc1ccccc1OC |
| InChI | InChI=1S/C19H33NO4Si/c1-19(2,3)25(6,7)24-13-12-15(14-18(21)23-5)20-16-10-8-9-11-17(16)22-4/h8-11,15,20H,12-14H2,1-7H3 |
| InChIKey | CBGXCYGLBUVKQI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|