C21H30ClNO5Si — CID 66894526
methyl (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoate (PubChem CID 66894526) has the molecular formula C21H30ClNO5Si and a molecular weight of 440.01 g/mol. Its IUPAC name is methyl (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoate.
| Compound Name | methyl (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 66894526 |
| Molecular Formula | C21H30ClNO5Si |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoate |
| SMILES | COC(=O)[C@H](CCO[Si](C)(C)C(C)(C)C)N1CC(Oc2ccccc2Cl)=CC1=O |
| InChI | InChI=1S/C21H30ClNO5Si/c1-21(2,3)29(5,6)27-12-11-17(20(25)26-4)23-14-15(13-19(23)24)28-18-10-8-7-9-16(18)22/h7-10,13,17H,11-12,14H2,1-6H3/t17-/m0/s1 |
| InChIKey | NHVYHEDLEFGFJJ-KRWDZBQOSA-N |
| XLogP | 4.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|