C20H28ClNO5Si — CID 91131922
(2S)-4-[butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoic acid (PubChem CID 91131922) has the molecular formula C20H28ClNO5Si and a molecular weight of 425.99 g/mol. Its IUPAC name is (2S)-4-[butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoic acid.
| Compound Name | (2S)-4-[butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 91131922 |
| Molecular Formula | C20H28ClNO5Si |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (2S)-4-[butyl(dimethyl)silyl]oxy-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]butanoic acid |
| SMILES | CCCC[Si](C)(C)OCC[C@@H](C(=O)O)N1CC(Oc2ccccc2Cl)=CC1=O |
| InChI | InChI=1S/C20H28ClNO5Si/c1-4-5-12-28(2,3)26-11-10-17(20(24)25)22-14-15(13-19(22)23)27-18-9-7-6-8-16(18)21/h6-9,13,17H,4-5,10-12,14H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | JWKUJNZYFKSVTI-KRWDZBQOSA-N |
| XLogP | 4.31 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|