C18H21NO6 — CID 66894384
2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-3-[(2S)-oxolan-2-yl]propanoic acid (PubChem CID 66894384) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-3-[(2S)-oxolan-2-yl]propanoic acid.
| Compound Name | 2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-3-[(2S)-oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 66894384 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-3-[(2S)-oxolan-2-yl]propanoic acid |
| SMILES | COc1ccccc1OC1=CC(=O)N(C(C[C@@H]2CCCO2)C(=O)O)C1 |
| InChI | InChI=1S/C18H21NO6/c1-23-15-6-2-3-7-16(15)25-13-10-17(20)19(11-13)14(18(21)22)9-12-5-4-8-24-12/h2-3,6-7,10,12,14H,4-5,8-9,11H2,1H3,(H,21,22)/t12-,14?/m0/s1 |
| InChIKey | AWFYHOFMWRTCQC-NBFOIZRFSA-N |
| XLogP | 1.82 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |