C18H28N2O4 — CID 95158383
N-[2-(dimethylamino)ethyl]-2-(2-methoxyphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 95158383) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(2-methoxyphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(2-methoxyphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 95158383 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(2-methoxyphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)N(CCN(C)C)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H28N2O4/c1-19(2)10-11-20(13-15-7-6-12-23-15)18(21)14-24-17-9-5-4-8-16(17)22-3/h4-5,8-9,15H,6-7,10-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | XZGSSAFQLJCRGR-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |