C16H21BrClNO3 — CID 3352017
2-(2-bromo-4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-propylacetamide (PubChem CID 3352017) has the molecular formula C16H21BrClNO3 and a molecular weight of 390.71 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-propylacetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-propylacetamide |
|---|---|
| PubChem CID | 3352017 |
| Molecular Formula | C16H21BrClNO3 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-propylacetamide |
| SMILES | CCCN(CC1CCCO1)C(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C16H21BrClNO3/c1-2-7-19(10-13-4-3-8-21-13)16(20)11-22-15-6-5-12(18)9-14(15)17/h5-6,9,13H,2-4,7-8,10-11H2,1H3 |
| InChIKey | YVNCROHFJMBFGM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |