C17H24ClNO3 — CID 91764944
2-(4-chloro-2-methylphenoxy)-N-ethyl-N-(oxan-2-ylmethyl)acetamide (PubChem CID 91764944) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-ethyl-N-(oxan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-ethyl-N-(oxan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 91764944 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-ethyl-N-(oxan-2-ylmethyl)acetamide |
| SMILES | CCN(CC1CCCCO1)C(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C17H24ClNO3/c1-3-19(11-15-6-4-5-9-21-15)17(20)12-22-16-8-7-14(18)10-13(16)2/h7-8,10,15H,3-6,9,11-12H2,1-2H3 |
| InChIKey | AYVOMUZWRBBQEI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |