C17H23Cl2NO3 — CID 60568779
4-(2,4-dichlorophenoxy)-N-ethyl-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 60568779) has the molecular formula C17H23Cl2NO3 and a molecular weight of 360.28 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-ethyl-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-ethyl-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 60568779 |
| Molecular Formula | C17H23Cl2NO3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-ethyl-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | CCN(CC1CCCO1)C(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H23Cl2NO3/c1-2-20(12-14-5-3-9-22-14)17(21)6-4-10-23-16-8-7-13(18)11-15(16)19/h7-8,11,14H,2-6,9-10,12H2,1H3 |
| InChIKey | LYKGPAHUBCLGRP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|