C21H23Cl2NO4 — CID 17170185
4-(2,4-dichlorophenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]butanamide (PubChem CID 17170185) has the molecular formula C21H23Cl2NO4 and a molecular weight of 424.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 17170185 |
| Molecular Formula | C21H23Cl2NO4 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C21H23Cl2NO4/c22-15-9-10-19(17(23)13-15)27-12-4-8-21(25)24-18-6-1-2-7-20(18)28-14-16-5-3-11-26-16/h1-2,6-7,9-10,13,16H,3-5,8,11-12,14H2,(H,24,25) |
| InChIKey | ZGQKMJUFZMMXNQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|