C15H22Cl2N2O3 — CID 119300240
4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]butanamide;hydrochloride (PubChem CID 119300240) has the molecular formula C15H22Cl2N2O3 and a molecular weight of 349.26 g/mol. Its IUPAC name is 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119300240 |
| Molecular Formula | C15H22Cl2N2O3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C15H21ClN2O3.ClH/c16-11-5-6-14(21-10-12-3-2-8-20-12)13(9-11)18-15(19)4-1-7-17;/h5-6,9,12H,1-4,7-8,10,17H2,(H,18,19);1H |
| InChIKey | ZJCPHLPXIWVUPV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |