C19H30N2O3 — CID 119743232
7-amino-N-[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]heptanamide (PubChem CID 119743232) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 7-amino-N-[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]heptanamide.
| Compound Name | 7-amino-N-[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]heptanamide |
|---|---|
| PubChem CID | 119743232 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 7-amino-N-[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]heptanamide |
| SMILES | Cc1ccc(NC(=O)CCCCCCN)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-15-9-10-17(21-19(22)8-4-2-3-5-11-20)18(13-15)24-14-16-7-6-12-23-16/h9-10,13,16H,2-8,11-12,14,20H2,1H3,(H,21,22) |
| InChIKey | XSIQTWWDHLDDNT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|