C17H22ClNO5 — CID 52505583
ethyl 4-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]anilino]-4-oxobutanoate (PubChem CID 52505583) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl 4-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 52505583 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 4-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cc(Cl)ccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H22ClNO5/c1-2-22-17(21)8-7-16(20)19-14-10-12(18)5-6-15(14)24-11-13-4-3-9-23-13/h5-6,10,13H,2-4,7-9,11H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | YKVZCQRUBMDRIV-ZDUSSCGKSA-N |
| XLogP | 3.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |