C16H23ClN2O4 — CID 120589868
4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybutanamide (PubChem CID 120589868) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120589868 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-amino-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C16H23ClN2O4/c1-21-13(9-18)8-16(20)19-14-7-11(17)4-5-15(14)23-10-12-3-2-6-22-12/h4-5,7,12-13H,2-3,6,8-10,18H2,1H3,(H,19,20) |
| InChIKey | IFYKTMXMNRVQAF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |