C21H29ClN2O4 — CID 60575055
N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 60575055) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60575055 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)Nc2cc(Cl)ccc2OCC2CCCO2)CC1 |
| InChI | InChI=1S/C21H29ClN2O4/c1-14(2)21(26)24-9-7-15(8-10-24)20(25)23-18-12-16(22)5-6-19(18)28-13-17-4-3-11-27-17/h5-6,12,14-15,17H,3-4,7-11,13H2,1-2H3,(H,23,25) |
| InChIKey | VKHFDISVRRSERH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |