C17H20ClNO5 — CID 120976807
2-[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120976807) has the molecular formula C17H20ClNO5 and a molecular weight of 353.80 g/mol. Its IUPAC name is 2-[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120976807 |
| Molecular Formula | C17H20ClNO5 |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C17H20ClNO5/c18-10-3-6-15(24-9-11-2-1-7-23-11)14(8-10)19-16(20)12-4-5-13(12)17(21)22/h3,6,8,11-13H,1-2,4-5,7,9H2,(H,19,20)(H,21,22) |
| InChIKey | DSDLVJLFUUBLSR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |