C18H18ClN3O4 — CID 102561239
6-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 102561239) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 6-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 102561239 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 6-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2cc(Cl)ccc2OCC2CCCO2)n1 |
| InChI | InChI=1S/C18H18ClN3O4/c19-11-6-7-16(26-10-12-3-2-8-25-12)15(9-11)22-18(24)14-5-1-4-13(21-14)17(20)23/h1,4-7,9,12H,2-3,8,10H2,(H2,20,23)(H,22,24) |
| InChIKey | KWGWQGYMYFBFRX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |