C17H19ClN4O3 — CID 99823794
3-amino-N-[5-chloro-2-[[(2R)-oxan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide (PubChem CID 99823794) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 3-amino-N-[5-chloro-2-[[(2R)-oxan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[5-chloro-2-[[(2R)-oxan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 99823794 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-amino-N-[5-chloro-2-[[(2R)-oxan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)Nc1cc(Cl)ccc1OC[C@H]1CCCCO1 |
| InChI | InChI=1S/C17H19ClN4O3/c18-11-4-5-14(25-10-12-3-1-2-8-24-12)13(9-11)22-17(23)15-16(19)21-7-6-20-15/h4-7,9,12H,1-3,8,10H2,(H2,19,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | MRIIBMHGJWAEQZ-GFCCVEGCSA-N |
| XLogP | 2.91 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |