C18H18ClN5O3 — CID 59158566
1-[5-chloro-2-[[(2S)-oxan-2-yl]methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea (PubChem CID 59158566) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is 1-[5-chloro-2-[[(2S)-oxan-2-yl]methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea.
| Compound Name | 1-[5-chloro-2-[[(2S)-oxan-2-yl]methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea |
|---|---|
| PubChem CID | 59158566 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1-[5-chloro-2-[[(2S)-oxan-2-yl]methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea |
| SMILES | N#Cc1cnc(NC(=O)Nc2cc(Cl)ccc2OC[C@@H]2CCCCO2)cn1 |
| InChI | InChI=1S/C18H18ClN5O3/c19-12-4-5-16(27-11-14-3-1-2-6-26-14)15(7-12)23-18(25)24-17-10-21-13(8-20)9-22-17/h4-5,7,9-10,14H,1-3,6,11H2,(H2,22,23,24,25)/t14-/m0/s1 |
| InChIKey | KMRYPOZZJSLKCA-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |