C19H26ClNO4 — CID 122033171
4-[5-chloro-2-(oxan-2-ylmethoxy)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122033171) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is 4-[5-chloro-2-(oxan-2-ylmethoxy)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[5-chloro-2-(oxan-2-ylmethoxy)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122033171 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-[5-chloro-2-(oxan-2-ylmethoxy)anilino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cc(Cl)ccc2OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C19H26ClNO4/c20-14-6-9-18(25-12-16-3-1-2-10-24-16)17(11-14)21-15-7-4-13(5-8-15)19(22)23/h6,9,11,13,15-16,21H,1-5,7-8,10,12H2,(H,22,23) |
| InChIKey | JJGPFPGSLNRUFR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |