C14H19ClN2O4 — CID 95265922
1-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-hydroxyethyl)urea (PubChem CID 95265922) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 95265922 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-[5-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1cc(Cl)ccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H19ClN2O4/c15-10-3-4-13(21-9-11-2-1-7-20-11)12(8-10)17-14(19)16-5-6-18/h3-4,8,11,18H,1-2,5-7,9H2,(H2,16,17,19)/t11-/m0/s1 |
| InChIKey | BCSWAFZDAOPVLJ-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |