C21H25ClN4O3 — CID 60576266
N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 60576266) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60576266 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC1CCCO1)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-16-4-5-19(29-14-17-3-1-12-28-17)18(13-16)25-20(27)15-6-10-26(11-7-15)21-23-8-2-9-24-21/h2,4-5,8-9,13,15,17H,1,3,6-7,10-12,14H2,(H,25,27) |
| InChIKey | MINGTDQYHLNXBL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |