C20H16Cl2F5NO3 — CID 40871167
N-[(2,4-dichlorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide (PubChem CID 40871167) has the molecular formula C20H16Cl2F5NO3 and a molecular weight of 484.25 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 40871167 |
| Molecular Formula | C20H16Cl2F5NO3 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
| SMILES | O=C(COc1c(F)c(F)c(F)c(F)c1F)N(Cc1ccc(Cl)cc1Cl)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H16Cl2F5NO3/c21-11-4-3-10(13(22)6-11)7-28(8-12-2-1-5-30-12)14(29)9-31-20-18(26)16(24)15(23)17(25)19(20)27/h3-4,6,12H,1-2,5,7-9H2/t12-/m1/s1 |
| InChIKey | USBAAMKXRIOZOS-GFCCVEGCSA-N |
| XLogP | 5.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|