C16H25N3O2S — CID 131895770
N-[2-(dimethylamino)ethyl]-N-(oxolan-2-ylmethyl)-2-pyridin-4-ylsulfanylacetamide (PubChem CID 131895770) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(oxolan-2-ylmethyl)-2-pyridin-4-ylsulfanylacetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(oxolan-2-ylmethyl)-2-pyridin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 131895770 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(oxolan-2-ylmethyl)-2-pyridin-4-ylsulfanylacetamide |
| SMILES | CN(C)CCN(CC1CCCO1)C(=O)CSc1ccncc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-18(2)9-10-19(12-14-4-3-11-21-14)16(20)13-22-15-5-7-17-8-6-15/h5-8,14H,3-4,9-13H2,1-2H3 |
| InChIKey | KIFPFMOWGVCUES-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |