C20H25NO4S — CID 86840515
2-(4-ethoxyphenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 86840515) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86840515 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CCOc1ccc(SCC(=O)N(Cc2ccco2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-2-23-16-7-9-19(10-8-16)26-15-20(22)21(13-17-5-3-11-24-17)14-18-6-4-12-25-18/h3,5,7-11,18H,2,4,6,12-15H2,1H3 |
| InChIKey | SKMRYDANZBJKRZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |