C15H22N2O4 — CID 665462
N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)morpholine-4-carboxamide (PubChem CID 665462) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)morpholine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 665462 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)morpholine-4-carboxamide |
| SMILES | O=C(N1CCOCC1)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C15H22N2O4/c18-15(16-5-9-19-10-6-16)17(11-13-3-1-7-20-13)12-14-4-2-8-21-14/h1,3,7,14H,2,4-6,8-12H2 |
| InChIKey | QZJWRASKWDFGCW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |