C17H27N3O4 — CID 94594071
1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)-1-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 94594071) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)-1-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94594071 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NCCN1CCOCC1)N(Cc1ccco1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C17H27N3O4/c21-17(18-5-6-19-7-11-22-12-8-19)20(13-15-3-1-9-23-15)14-16-4-2-10-24-16/h1,3,9,16H,2,4-8,10-14H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | BJLLKNPDQFTBJK-MRXNPFEDSA-N |
| XLogP | 1.30 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |