C21H27NO5 — CID 66895519
methyl (2S)-3-cyclohexyl-2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]propanoate (PubChem CID 66895519) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl (2S)-3-cyclohexyl-2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]propanoate.
| Compound Name | methyl (2S)-3-cyclohexyl-2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 66895519 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | methyl (2S)-3-cyclohexyl-2-[3-(2-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]propanoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)N1CC(Oc2ccccc2OC)=CC1=O |
| InChI | InChI=1S/C21H27NO5/c1-25-18-10-6-7-11-19(18)27-16-13-20(23)22(14-16)17(21(24)26-2)12-15-8-4-3-5-9-15/h6-7,10-11,13,15,17H,3-5,8-9,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | DIHPPGKDQFNXIO-KRWDZBQOSA-N |
| XLogP | 3.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |