C28H40N4O6 — CID 143878550
(2S)-3-cyclohexyl-2-[3-(2,3-dimethoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide (PubChem CID 143878550) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[3-(2,3-dimethoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide.
| Compound Name | (2S)-3-cyclohexyl-2-[3-(2,3-dimethoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
|---|---|
| PubChem CID | 143878550 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[3-(2,3-dimethoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
| SMILES | [H]/N=C(\C=C/NCC(C)(C)O)NC(=O)[C@H](CC1CCCCC1)N1CC(Oc2cccc(OC)c2OC)=CC1=O |
| InChI | InChI=1S/C28H40N4O6/c1-28(2,35)18-30-14-13-24(29)31-27(34)21(15-19-9-6-5-7-10-19)32-17-20(16-25(32)33)38-23-12-8-11-22(36-3)26(23)37-4/h8,11-14,16,19,21,30,35H,5-7,9-10,15,17-18H2,1-4H3,(H2,29,31,34)/b14-13-/t21-/m0/s1 |
| InChIKey | ITOZORNHZICVPB-HJBMFWNLSA-N |
| XLogP | 3.12 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|