C26H35FN4O4 — CID 143878706
(2S)-3-cyclohexyl-2-[3-(3-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide (PubChem CID 143878706) has the molecular formula C26H35FN4O4 and a molecular weight of 486.59 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[3-(3-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide.
| Compound Name | (2S)-3-cyclohexyl-2-[3-(3-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
|---|---|
| PubChem CID | 143878706 |
| Molecular Formula | C26H35FN4O4 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[3-(3-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
| SMILES | [H]/N=C(\C=C/NCC(C)(C)O)NC(=O)[C@H](CC1CCCCC1)N1CC(Oc2cccc(F)c2)=CC1=O |
| InChI | InChI=1S/C26H35FN4O4/c1-26(2,34)17-29-12-11-23(28)30-25(33)22(13-18-7-4-3-5-8-18)31-16-21(15-24(31)32)35-20-10-6-9-19(27)14-20/h6,9-12,14-15,18,22,29,34H,3-5,7-8,13,16-17H2,1-2H3,(H2,28,30,33)/b12-11-/t22-/m0/s1 |
| InChIKey | QFTVIJJEEBEWLY-GJCOWUBNSA-N |
| XLogP | 3.24 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|