C23H31N3O4S — CID 163505745
3-cyclopentyl-2-(1,1-dioxo-1-benzothiophen-5-yl)-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide (PubChem CID 163505745) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 3-cyclopentyl-2-(1,1-dioxo-1-benzothiophen-5-yl)-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide.
| Compound Name | 3-cyclopentyl-2-(1,1-dioxo-1-benzothiophen-5-yl)-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
|---|---|
| PubChem CID | 163505745 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-cyclopentyl-2-(1,1-dioxo-1-benzothiophen-5-yl)-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
| SMILES | [H]/N=C(\C=C/NCC(C)(C)O)NC(=O)C(CC1CCCC1)c1ccc2c(c1)C=CS2(=O)=O |
| InChI | InChI=1S/C23H31N3O4S/c1-23(2,28)15-25-11-9-21(24)26-22(27)19(13-16-5-3-4-6-16)17-7-8-20-18(14-17)10-12-31(20,29)30/h7-12,14,16,19,25,28H,3-6,13,15H2,1-2H3,(H2,24,26,27)/b11-9- |
| InChIKey | CYKMZGUHWLTMFS-LUAWRHEFSA-N |
| XLogP | 3.08 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|