C16H20Cl2N2OS — CID 46223569
3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(methylcarbamothioyl)propanamide (PubChem CID 46223569) has the molecular formula C16H20Cl2N2OS and a molecular weight of 359.32 g/mol. Its IUPAC name is 3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(methylcarbamothioyl)propanamide.
| Compound Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(methylcarbamothioyl)propanamide |
|---|---|
| PubChem CID | 46223569 |
| Molecular Formula | C16H20Cl2N2OS |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(methylcarbamothioyl)propanamide |
| SMILES | CNC(=S)NC(=O)C(CC1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2OS/c1-19-16(22)20-15(21)12(8-10-4-2-3-5-10)11-6-7-13(17)14(18)9-11/h6-7,9-10,12H,2-5,8H2,1H3,(H2,19,20,21,22) |
| InChIKey | SXALTAXBVRBHJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|