C26H35ClN4O5 — CID 143878691
(4R)-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[1-[3-(2-hydroxypropan-2-yloxy)propyl]pyrazol-3-yl]-4-methylhexanamide (PubChem CID 143878691) has the molecular formula C26H35ClN4O5 and a molecular weight of 519.04 g/mol. Its IUPAC name is (4R)-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[1-[3-(2-hydroxypropan-2-yloxy)propyl]pyrazol-3-yl]-4-methylhexanamide.
| Compound Name | (4R)-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[1-[3-(2-hydroxypropan-2-yloxy)propyl]pyrazol-3-yl]-4-methylhexanamide |
|---|---|
| PubChem CID | 143878691 |
| Molecular Formula | C26H35ClN4O5 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (4R)-2-[3-(2-chlorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[1-[3-(2-hydroxypropan-2-yloxy)propyl]pyrazol-3-yl]-4-methylhexanamide |
| SMILES | CC[C@@H](C)CC(C(=O)Nc1ccn(CCCOC(C)(C)O)n1)N1CC(Oc2ccccc2Cl)=CC1=O |
| InChI | InChI=1S/C26H35ClN4O5/c1-5-18(2)15-21(31-17-19(16-24(31)32)36-22-10-7-6-9-20(22)27)25(33)28-23-11-13-30(29-23)12-8-14-35-26(3,4)34/h6-7,9-11,13,16,18,21,34H,5,8,12,14-15,17H2,1-4H3,(H,28,29,33)/t18-,21?/m1/s1 |
| InChIKey | RZWYJPAVHOAKKB-ITUIMRKVSA-N |
| XLogP | 4.22 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|