C28H43NO4Si — CID 10917891
(4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyanilino)-5-phenylmethoxyoctan-2-one (PubChem CID 10917891) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyanilino)-5-phenylmethoxyoctan-2-one.
| Compound Name | (4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyanilino)-5-phenylmethoxyoctan-2-one |
|---|---|
| PubChem CID | 10917891 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyanilino)-5-phenylmethoxyoctan-2-one |
| SMILES | COc1ccccc1N[C@H](CC(C)=O)[C@H](CCCO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C28H43NO4Si/c1-22(30)20-25(29-24-16-11-12-17-26(24)31-5)27(32-21-23-14-9-8-10-15-23)18-13-19-33-34(6,7)28(2,3)4/h8-12,14-17,25,27,29H,13,18-21H2,1-7H3/t25-,27+/m1/s1 |
| InChIKey | XGGWSKUPTZZUAI-VPUSJEBWSA-N |
| XLogP | 6.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|