C31H48O5Si — CID 102245377
(5S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-1,7-bis(phenylmethoxy)nonan-3-one (PubChem CID 102245377) has the molecular formula C31H48O5Si and a molecular weight of 528.81 g/mol. Its IUPAC name is (5S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-1,7-bis(phenylmethoxy)nonan-3-one.
| Compound Name | (5S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-1,7-bis(phenylmethoxy)nonan-3-one |
|---|---|
| PubChem CID | 102245377 |
| Molecular Formula | C31H48O5Si |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (5S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-1,7-bis(phenylmethoxy)nonan-3-one |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)[C@H](C[C@H](O)CC(=O)CCOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H48O5Si/c1-30(2,3)37(6,7)36-24-31(4,5)29(35-23-26-16-12-9-13-17-26)21-28(33)20-27(32)18-19-34-22-25-14-10-8-11-15-25/h8-17,28-29,33H,18-24H2,1-7H3/t28-,29+/m1/s1 |
| InChIKey | OSARLRIFBDFDCS-WDYNHAJCSA-N |
| XLogP | 6.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|