C20H34O5Si — CID 68852687
benzyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-diethoxypropanoate (PubChem CID 68852687) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is benzyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-diethoxypropanoate.
| Compound Name | benzyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-diethoxypropanoate |
|---|---|
| PubChem CID | 68852687 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | benzyl 3-[tert-butyl(dimethyl)silyl]oxy-2,2-diethoxypropanoate |
| SMILES | CCOC(CO[Si](C)(C)C(C)(C)C)(OCC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H34O5Si/c1-8-23-20(24-9-2,16-25-26(6,7)19(3,4)5)18(21)22-15-17-13-11-10-12-14-17/h10-14H,8-9,15-16H2,1-7H3 |
| InChIKey | MDRWRVPXPSANQJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|