C19H29NO8S — CID 25226464
benzyl 3-(3-acetamidopropylsulfonyloxy)-2,2-diethoxypropanoate (PubChem CID 25226464) has the molecular formula C19H29NO8S and a molecular weight of 431.51 g/mol. Its IUPAC name is benzyl 3-(3-acetamidopropylsulfonyloxy)-2,2-diethoxypropanoate.
| Compound Name | benzyl 3-(3-acetamidopropylsulfonyloxy)-2,2-diethoxypropanoate |
|---|---|
| PubChem CID | 25226464 |
| Molecular Formula | C19H29NO8S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | benzyl 3-(3-acetamidopropylsulfonyloxy)-2,2-diethoxypropanoate |
| SMILES | CCOC(COS(=O)(=O)CCCNC(C)=O)(OCC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29NO8S/c1-4-26-19(27-5-2,18(22)25-14-17-10-7-6-8-11-17)15-28-29(23,24)13-9-12-20-16(3)21/h6-8,10-11H,4-5,9,12-15H2,1-3H3,(H,20,21) |
| InChIKey | RKVNAJYRLWPWNP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|