C17H31NO10S — CID 87423562
4-methoxycarbonyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423562) has the molecular formula C17H31NO10S and a molecular weight of 441.50 g/mol. Its IUPAC name is 4-methoxycarbonyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 4-methoxycarbonyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423562 |
| Molecular Formula | C17H31NO10S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-methoxycarbonyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | COC(=O)OCCCCOC(=O)[C@H](O)C(C)(C)COS(=O)(=O)CCCNC(C)=O |
| InChI | InChI=1S/C17H31NO10S/c1-13(19)18-8-7-11-29(23,24)28-12-17(2,3)14(20)15(21)26-9-5-6-10-27-16(22)25-4/h14,20H,5-12H2,1-4H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | QEZNAZZLIAXIHC-AWEZNQCLSA-N |
| XLogP | 0.35 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|