C15H31ClN2O7S — CID 86629034
2-(dimethylamino)ethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate;hydrochloride (PubChem CID 86629034) has the molecular formula C15H31ClN2O7S and a molecular weight of 418.94 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate;hydrochloride.
| Compound Name | 2-(dimethylamino)ethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 86629034 |
| Molecular Formula | C15H31ClN2O7S |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-(dimethylamino)ethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate;hydrochloride |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O)C(=O)OCCN(C)C.Cl |
| InChI | InChI=1S/C15H30N2O7S.ClH/c1-12(18)16-7-6-10-25(21,22)24-11-15(2,3)13(19)14(20)23-9-8-17(4)5;/h13,19H,6-11H2,1-5H3,(H,16,18);1H/t13-;/m0./s1 |
| InChIKey | JGEUECBSSKAFBP-ZOWNYOTGSA-N |
| XLogP | -0.23 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|