C19H35NO9S — CID 87423714
[(2R)-2-(2,2-dimethylpropanoyloxy)propyl] 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423714) has the molecular formula C19H35NO9S and a molecular weight of 453.55 g/mol. Its IUPAC name is [(2R)-2-(2,2-dimethylpropanoyloxy)propyl] 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | [(2R)-2-(2,2-dimethylpropanoyloxy)propyl] 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423714 |
| Molecular Formula | C19H35NO9S |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | [(2R)-2-(2,2-dimethylpropanoyloxy)propyl] 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)C(O)C(=O)OC[C@@H](C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H35NO9S/c1-13(29-17(24)18(3,4)5)11-27-16(23)15(22)19(6,7)12-28-30(25,26)10-8-9-20-14(2)21/h13,15,22H,8-12H2,1-7H3,(H,20,21)/t13-,15?/m1/s1 |
| InChIKey | TWXVIFWAEFCHOI-AFYYWNPRSA-N |
| XLogP | 0.77 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|